C17H26N2 — CID 165125144
1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine (PubChem CID 165125144) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine.
| Compound Name | 1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 165125144 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine |
| SMILES | C1=CCNCC1.CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C12H17N.C5H9N/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-4-6-5-3-1/h2-6,12H,7-10H2,1H3;1-2,6H,3-5H2 |
| InChIKey | BNXBWGLEYWHPIO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|