C10H19N3O4 — CID 165125174
tert-butyl N-[3-[[amino(methoxy)methylidene]amino]-3-oxopropyl]carbamate (PubChem CID 165125174) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino(methoxy)methylidene]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[amino(methoxy)methylidene]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 165125174 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | tert-butyl N-[3-[[amino(methoxy)methylidene]amino]-3-oxopropyl]carbamate |
| SMILES | CO/C(N)=N\C(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O4/c1-10(2,3)17-9(15)12-6-5-7(14)13-8(11)16-4/h5-6H2,1-4H3,(H,12,15)(H2,11,13,14) |
| InChIKey | XFEVCEAMGLHGSM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|