C24H34N4O5S — CID 16512677
[2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxylate (PubChem CID 16512677) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxylate.
| Compound Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 16512677 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [2-[(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-butylamino]-2-oxoethyl] 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxylate |
| SMILES | CCCCN(C(=O)COC(=O)c1cc2c(s1)CCCCCC2)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H34N4O5S/c1-3-5-13-27(20-21(25)28(12-4-2)24(32)26-22(20)30)19(29)15-33-23(31)18-14-16-10-8-6-7-9-11-17(16)34-18/h14H,3-13,15,25H2,1-2H3,(H,26,30,32) |
| InChIKey | LTYRDUBMUINTLE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |