C19H19N3O2 — CID 165126942
N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]naphthalene-2-carboxamide (PubChem CID 165126942) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]naphthalene-2-carboxamide.
| Compound Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 165126942 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1cnn(CC2CCCO2)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H19N3O2/c23-19(16-8-7-14-4-1-2-5-15(14)10-16)21-17-11-20-22(12-17)13-18-6-3-9-24-18/h1-2,4-5,7-8,10-12,18H,3,6,9,13H2,(H,21,23) |
| InChIKey | NNFOOZKFQRTEDD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |