C32H56N2O2 — CID 165127075
ethane;3-methyl-1-(3-methylbutoxy)butane;N-methyl-N-[4-methyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]phenyl]oxan-2-amine (PubChem CID 165127075) has the molecular formula C32H56N2O2 and a molecular weight of 500.81 g/mol. Its IUPAC name is ethane;3-methyl-1-(3-methylbutoxy)butane;N-methyl-N-[4-methyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]phenyl]oxan-2-amine.
| Compound Name | ethane;3-methyl-1-(3-methylbutoxy)butane;N-methyl-N-[4-methyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]phenyl]oxan-2-amine |
|---|---|
| PubChem CID | 165127075 |
| Molecular Formula | C32H56N2O2 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 500.43 |
| IUPAC Name | ethane;3-methyl-1-(3-methylbutoxy)butane;N-methyl-N-[4-methyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]phenyl]oxan-2-amine |
| SMILES | C=C(C(=C/C)/C=N/C)c1cc(C)ccc1N(C)C1CCCCO1.CC.CC(C)CCOCCC(C)C |
| InChI | InChI=1S/C20H28N2O.C10H22O.C2H6/c1-6-17(14-21-4)16(3)18-13-15(2)10-11-19(18)22(5)20-9-7-8-12-23-20;1-9(2)5-7-11-8-6-10(3)4;1-2/h6,10-11,13-14,20H,3,7-9,12H2,1-2,4-5H3;9-10H,5-8H2,1-4H3;1-2H3/b17-6+,21-14+;; |
| InChIKey | PPKQCNIPXVUGDI-GXZBUAANSA-N |
| XLogP | 8.74 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|