C17H19FN4O3 — CID 165127091
(13R)-17-fluoro-13-methyl-8,11,14-trioxa-4,5,19,20-tetrazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene (PubChem CID 165127091) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is (13R)-17-fluoro-13-methyl-8,11,14-trioxa-4,5,19,20-tetrazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene.
| Compound Name | (13R)-17-fluoro-13-methyl-8,11,14-trioxa-4,5,19,20-tetrazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene |
|---|---|
| PubChem CID | 165127091 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (13R)-17-fluoro-13-methyl-8,11,14-trioxa-4,5,19,20-tetrazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene |
| SMILES | C[C@@H]1COCCOCCn2cc(cn2)-c2n[nH]c3c(F)cc(cc23)O1 |
| InChI | InChI=1S/C17H19FN4O3/c1-11-10-24-5-4-23-3-2-22-9-12(8-19-22)16-14-6-13(25-11)7-15(18)17(14)21-20-16/h6-9,11H,2-5,10H2,1H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | XQYJQMBODVGRFX-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |