C34H37N3OS — CID 165127141
methyl N-[(1Z)-4-[5-(benzhydrylideneamino)-2-[methyl(oxan-2-yl)amino]phenyl]-3-methylidenepenta-1,4-dienyl]ethanimidothioate (PubChem CID 165127141) has the molecular formula C34H37N3OS and a molecular weight of 535.76 g/mol. Its IUPAC name is methyl N-[(1Z)-4-[5-(benzhydrylideneamino)-2-[methyl(oxan-2-yl)amino]phenyl]-3-methylidenepenta-1,4-dienyl]ethanimidothioate.
| Compound Name | methyl N-[(1Z)-4-[5-(benzhydrylideneamino)-2-[methyl(oxan-2-yl)amino]phenyl]-3-methylidenepenta-1,4-dienyl]ethanimidothioate |
|---|---|
| PubChem CID | 165127141 |
| Molecular Formula | C34H37N3OS |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | methyl N-[(1Z)-4-[5-(benzhydrylideneamino)-2-[methyl(oxan-2-yl)amino]phenyl]-3-methylidenepenta-1,4-dienyl]ethanimidothioate |
| SMILES | C=C(/C=C\N=C(/C)SC)C(=C)c1cc(N=C(c2ccccc2)c2ccccc2)ccc1N(C)C1CCCCO1 |
| InChI | InChI=1S/C34H37N3OS/c1-25(21-22-35-27(3)39-5)26(2)31-24-30(19-20-32(31)37(4)33-18-12-13-23-38-33)36-34(28-14-8-6-9-15-28)29-16-10-7-11-17-29/h6-11,14-17,19-22,24,33H,1-2,12-13,18,23H2,3-5H3/b22-21-,35-27+ |
| InChIKey | WEVKHHSCECFMCW-MOUDLYRUSA-N |
| XLogP | 8.68 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|