C30H46N2O3 — CID 165127227
N-[2-[2-[[(E)-2-(1-butoxypropan-2-yloxy)prop-1-enyl]iminomethyl]-4-methylhexa-1,3-dien-3-yl]-4-methylphenyl]oxan-2-amine (PubChem CID 165127227) has the molecular formula C30H46N2O3 and a molecular weight of 482.71 g/mol. Its IUPAC name is N-[2-[2-[[(E)-2-(1-butoxypropan-2-yloxy)prop-1-enyl]iminomethyl]-4-methylhexa-1,3-dien-3-yl]-4-methylphenyl]oxan-2-amine.
| Compound Name | N-[2-[2-[[(E)-2-(1-butoxypropan-2-yloxy)prop-1-enyl]iminomethyl]-4-methylhexa-1,3-dien-3-yl]-4-methylphenyl]oxan-2-amine |
|---|---|
| PubChem CID | 165127227 |
| Molecular Formula | C30H46N2O3 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | N-[2-[2-[[(E)-2-(1-butoxypropan-2-yloxy)prop-1-enyl]iminomethyl]-4-methylhexa-1,3-dien-3-yl]-4-methylphenyl]oxan-2-amine |
| SMILES | C=C(/C=N/C=C(\C)OC(C)COCCCC)C(=C(C)CC)c1cc(C)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C30H46N2O3/c1-8-10-16-33-21-26(7)35-25(6)20-31-19-24(5)30(23(4)9-2)27-18-22(3)14-15-28(27)32-29-13-11-12-17-34-29/h14-15,18-20,26,29,32H,5,8-13,16-17,21H2,1-4,6-7H3/b25-20+,30-23?,31-19+ |
| InChIKey | NDVSKTZOFWXPCG-XCQDDJICSA-N |
| XLogP | 7.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|