C23H38N2O2 — CID 165127244
N,4-dimethyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]aniline;1-(2-propoxyethoxy)propane (PubChem CID 165127244) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is N,4-dimethyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]aniline;1-(2-propoxyethoxy)propane.
| Compound Name | N,4-dimethyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]aniline;1-(2-propoxyethoxy)propane |
|---|---|
| PubChem CID | 165127244 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | N,4-dimethyl-2-[(3Z)-3-(methyliminomethyl)penta-1,3-dien-2-yl]aniline;1-(2-propoxyethoxy)propane |
| SMILES | C=C(C(=C/C)/C=N/C)c1cc(C)ccc1NC.CCCOCCOCCC |
| InChI | InChI=1S/C15H20N2.C8H18O2/c1-6-13(10-16-4)12(3)14-9-11(2)7-8-15(14)17-5;1-3-5-9-7-8-10-6-4-2/h6-10,17H,3H2,1-2,4-5H3;3-8H2,1-2H3/b13-6+,16-10+; |
| InChIKey | VENYGWZLJLENPW-KNIAEAGVSA-N |
| XLogP | 5.54 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|