C22H26Cl2N4O — CID 165128018
3-[5-[4-(2,4-dichlorophenyl)piperazin-1-yl]pentyl]-1H-benzimidazol-2-one (PubChem CID 165128018) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is 3-[5-[4-(2,4-dichlorophenyl)piperazin-1-yl]pentyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[5-[4-(2,4-dichlorophenyl)piperazin-1-yl]pentyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 165128018 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[5-[4-(2,4-dichlorophenyl)piperazin-1-yl]pentyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CCCCCN1CCN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H26Cl2N4O/c23-17-8-9-20(18(24)16-17)27-14-12-26(13-15-27)10-4-1-5-11-28-21-7-3-2-6-19(21)25-22(28)29/h2-3,6-9,16H,1,4-5,10-15H2,(H,25,29) |
| InChIKey | OPWXQBUQTBZEOV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|