C21H28FN5O — CID 165128653
(3Z,5Z)-2-ethylidene-6-[4-[(1E)-1-[2-fluoroethyl(methyl)amino]buta-1,3-dien-2-yl]-1-methylimidazol-2-yl]-5-methanimidoylhepta-3,5-dienamide (PubChem CID 165128653) has the molecular formula C21H28FN5O and a molecular weight of 385.49 g/mol. Its IUPAC name is (3Z,5Z)-2-ethylidene-6-[4-[(1E)-1-[2-fluoroethyl(methyl)amino]buta-1,3-dien-2-yl]-1-methylimidazol-2-yl]-5-methanimidoylhepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-2-ethylidene-6-[4-[(1E)-1-[2-fluoroethyl(methyl)amino]buta-1,3-dien-2-yl]-1-methylimidazol-2-yl]-5-methanimidoylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 165128653 |
| Molecular Formula | C21H28FN5O |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (3Z,5Z)-2-ethylidene-6-[4-[(1E)-1-[2-fluoroethyl(methyl)amino]buta-1,3-dien-2-yl]-1-methylimidazol-2-yl]-5-methanimidoylhepta-3,5-dienamide |
| SMILES | [H]/N=C/C(/C=C\C(=CC)C(N)=O)=C(/C)c1nc(/C(C=C)=C/N(C)CCF)cn1C |
| InChI | InChI=1S/C21H28FN5O/c1-6-16(20(24)28)8-9-18(12-23)15(3)21-25-19(14-27(21)5)17(7-2)13-26(4)11-10-22/h6-9,12-14,23H,2,10-11H2,1,3-5H3,(H2,24,28)/b9-8-,16-6?,17-13+,18-15-,23-12+ |
| InChIKey | BVRIFXYTXBJYRL-HDEZFZRWSA-N |
| XLogP | 3.26 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|