About (E)-4-iminopent-2-en-3-ol;pent-1-ene
(E)-4-iminopent-2-en-3-ol;pent-1-ene (PubChem CID 165128744) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (E)-4-iminopent-2-en-3-ol;pent-1-ene.
Molecular Properties
| Compound Name | (E)-4-iminopent-2-en-3-ol;pent-1-ene |
| PubChem CID | 165128744 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (E)-4-iminopent-2-en-3-ol;pent-1-ene |
| SMILES | C=CCCC.[H]/N=C(C)/C(O)=C\C |
| InChI | InChI=1S/C5H9NO.C5H10/c1-3-5(7)4(2)6;1-3-5-4-2/h3,6-7H,1-2H3;3H,1,4-5H2,2H3/b5-3+,6-4+; |
| InChIKey | KQEKECMRDQUGKG-WEUBHIEESA-N |
| XLogP | 3.46 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-iminopent-2-en-3-ol;pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-iminopent-2-en-3-ol;pent-1-ene?
The IUPAC name of (E)-4-iminopent-2-en-3-ol;pent-1-ene (CID 165128744) is (E)-4-iminopent-2-en-3-ol;pent-1-ene.
What is the SMILES notation for (E)-4-iminopent-2-en-3-ol;pent-1-ene?
The canonical SMILES for (E)-4-iminopent-2-en-3-ol;pent-1-ene is C=CCCC.[H]/N=C(C)/C(O)=C\C.
What is the InChIKey of (E)-4-iminopent-2-en-3-ol;pent-1-ene?
The InChIKey is KQEKECMRDQUGKG-WEUBHIEESA-N. The full InChI is InChI=1S/C5H9NO.C5H10/c1-3-5(7)4(2)6;1-3-5-4-2/h3,6-7H,1-2H3;3H,1,4-5H2,2H3/b5-3+,6-4+;.
What are the key properties of (E)-4-iminopent-2-en-3-ol;pent-1-ene?
(E)-4-iminopent-2-en-3-ol;pent-1-ene has a molecular weight of 169.27 g/mol, XLogP of 3.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-iminopent-2-en-3-ol;pent-1-ene is sourced from PubChem (CID 165128744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).