C22H33FN6O — CID 165128748
(3E,5Z)-4-amino-6-[4-[(Z)-3-fluoro-4-iminopent-2-en-2-yl]-1-methylimidazol-2-yl]-5-methanimidoyl-2-methylidenehepta-3,5-dienamide;butane (PubChem CID 165128748) has the molecular formula C22H33FN6O and a molecular weight of 416.55 g/mol. Its IUPAC name is (3E,5Z)-4-amino-6-[4-[(Z)-3-fluoro-4-iminopent-2-en-2-yl]-1-methylimidazol-2-yl]-5-methanimidoyl-2-methylidenehepta-3,5-dienamide;butane.
| Compound Name | (3E,5Z)-4-amino-6-[4-[(Z)-3-fluoro-4-iminopent-2-en-2-yl]-1-methylimidazol-2-yl]-5-methanimidoyl-2-methylidenehepta-3,5-dienamide;butane |
|---|---|
| PubChem CID | 165128748 |
| Molecular Formula | C22H33FN6O |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (3E,5Z)-4-amino-6-[4-[(Z)-3-fluoro-4-iminopent-2-en-2-yl]-1-methylimidazol-2-yl]-5-methanimidoyl-2-methylidenehepta-3,5-dienamide;butane |
| SMILES | CCCC.[H]/N=C/C(=C(/C)c1nc(/C(C)=C(F)/C(C)=N/[H])cn1C)/C(N)=C\C(=C)C(N)=O |
| InChI | InChI=1S/C18H23FN6O.C4H10/c1-9(17(23)26)6-14(22)13(7-20)10(2)18-24-15(8-25(18)5)11(3)16(19)12(4)21;1-3-4-2/h6-8,20-21H,1,22H2,2-5H3,(H2,23,26);3-4H2,1-2H3/b13-10+,14-6+,16-11-,20-7+,21-12+; |
| InChIKey | JZWYYZRXUDEKBA-PKLRBZJPSA-N |
| XLogP | 4.27 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|