About 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane
5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane (PubChem CID 165128821) has the molecular formula C15H19F2N5O2
and a molecular weight of 339.35 g/mol. Its IUPAC name is 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane.
Molecular Properties
| Compound Name | 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane |
| PubChem CID | 165128821 |
| Molecular Formula | C15H19F2N5O2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane |
| SMILES | CC.O=c1[nH]cc(-c2cc(N3CCC(F)(F)CC3)cnn2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H13F2N5O2.C2H6/c14-13(15)1-3-20(4-2-13)8-5-10(19-17-6-8)9-7-16-12(22)18-11(9)21;1-2/h5-7H,1-4H2,(H2,16,18,21,22);1-2H3 |
| InChIKey | BNTXPGAJEKLEQA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane?
The IUPAC name of 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane (CID 165128821) is 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane.
What is the SMILES notation for 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane?
The canonical SMILES for 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane is CC.O=c1[nH]cc(-c2cc(N3CCC(F)(F)CC3)cnn2)c(=O)[nH]1.
What is the InChIKey of 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane?
The InChIKey is BNTXPGAJEKLEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N5O2.C2H6/c14-13(15)1-3-20(4-2-13)8-5-10(19-17-6-8)9-7-16-12(22)18-11(9)21;1-2/h5-7H,1-4H2,(H2,16,18,21,22);1-2H3.
What are the key properties of 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane?
5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane has a molecular weight of 339.35 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(4,4-difluoropiperidin-1-yl)pyridazin-3-yl]-1H-pyrimidine-2,4-dione;ethane is sourced from PubChem (CID 165128821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).