C9H12Cl2F3N3 — CID 165128832
(1Z,3E)-1,4-dichloro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]buta-1,3-diene-1,4-diamine (PubChem CID 165128832) has the molecular formula C9H12Cl2F3N3 and a molecular weight of 290.12 g/mol. Its IUPAC name is (1Z,3E)-1,4-dichloro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]buta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3E)-1,4-dichloro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 165128832 |
| Molecular Formula | C9H12Cl2F3N3 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | (1Z,3E)-1,4-dichloro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]buta-1,3-diene-1,4-diamine |
| SMILES | N/C(Cl)=C(\C=C(/N)Cl)N1CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H12Cl2F3N3/c10-7(15)3-6(8(11)16)17-2-1-5(4-17)9(12,13)14/h3,5H,1-2,4,15-16H2/b7-3-,8-6+ |
| InChIKey | LDVRLLKERZBVKZ-SYTHDNBVSA-N |
| XLogP | 2.28 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|