C20H34F3N5 — CID 165128867
ethane;(1E,3Z,5E)-2-ethenyl-1-N-[1-(methylamino)ethenyl]-5-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,3,5-triene-1,3,6-triamine (PubChem CID 165128867) has the molecular formula C20H34F3N5 and a molecular weight of 401.52 g/mol. Its IUPAC name is ethane;(1E,3Z,5E)-2-ethenyl-1-N-[1-(methylamino)ethenyl]-5-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,3,5-triene-1,3,6-triamine.
| Compound Name | ethane;(1E,3Z,5E)-2-ethenyl-1-N-[1-(methylamino)ethenyl]-5-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,3,5-triene-1,3,6-triamine |
|---|---|
| PubChem CID | 165128867 |
| Molecular Formula | C20H34F3N5 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | ethane;(1E,3Z,5E)-2-ethenyl-1-N-[1-(methylamino)ethenyl]-5-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,3,5-triene-1,3,6-triamine |
| SMILES | C=CC(=C\NC(=C)NC)/C(N)=C/C(=C(/C)N)N1CCC(C(F)(F)F)CC1.CC |
| InChI | InChI=1S/C18H28F3N5.C2H6/c1-5-14(11-25-13(3)24-4)16(23)10-17(12(2)22)26-8-6-15(7-9-26)18(19,20)21;1-2/h5,10-11,15,24-25H,1,3,6-9,22-23H2,2,4H3;1-2H3/b14-11+,16-10-,17-12+; |
| InChIKey | OKZXKZQSSZRJGN-OVXAKHNVSA-N |
| XLogP | 3.67 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|