C21H26N4O3 — CID 165129140
3-[[(1E,3Z)-1,4-diamino-4-(oxolan-2-yl)buta-1,3-dienyl]amino]-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 165129140) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-[[(1E,3Z)-1,4-diamino-4-(oxolan-2-yl)buta-1,3-dienyl]amino]-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 3-[[(1E,3Z)-1,4-diamino-4-(oxolan-2-yl)buta-1,3-dienyl]amino]-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 165129140 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3-[[(1E,3Z)-1,4-diamino-4-(oxolan-2-yl)buta-1,3-dienyl]amino]-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2cccc(N/C(N)=C/C=C(\N)C3CCCO3)c2)o1 |
| InChI | InChI=1S/C21H26N4O3/c1-14-7-8-17(28-14)13-24-21(26)15-4-2-5-16(12-15)25-20(23)10-9-18(22)19-6-3-11-27-19/h2,4-5,7-10,12,19,25H,3,6,11,13,22-23H2,1H3,(H,24,26)/b18-9-,20-10+ |
| InChIKey | FITYIKKTYXHOQO-URNXOSEYSA-N |
| XLogP | 2.75 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|