About 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane
15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane (PubChem CID 165129271) has the molecular formula C18H27F6NO
and a molecular weight of 387.41 g/mol. Its IUPAC name is 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane.
Molecular Properties
| Compound Name | 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane |
| PubChem CID | 165129271 |
| Molecular Formula | C18H27F6NO |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane |
| SMILES | COC1CC2(CCC(C(F)(F)F)CC2)NC2(CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C18H27F6NO/c1-26-14-10-15(6-2-12(3-7-15)17(19,20)21)25-16(11-14)8-4-13(5-9-16)18(22,23)24/h12-14,25H,2-11H2,1H3 |
| InChIKey | JYHKEJYJOQXGHE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane?
The IUPAC name of 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane (CID 165129271) is 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane.
What is the SMILES notation for 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane?
The canonical SMILES for 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane is COC1CC2(CCC(C(F)(F)F)CC2)NC2(CCC(C(F)(F)F)CC2)C1.
What is the InChIKey of 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane?
The InChIKey is JYHKEJYJOQXGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F6NO/c1-26-14-10-15(6-2-12(3-7-15)17(19,20)21)25-16(11-14)8-4-13(5-9-16)18(22,23)24/h12-14,25H,2-11H2,1H3.
What are the key properties of 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane?
15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane has a molecular weight of 387.41 g/mol, XLogP of 5.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 15-methoxy-3,11-bis(trifluoromethyl)-7-azadispiro[5.1.58.36]hexadecane is sourced from PubChem (CID 165129271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).