C13H18F9NO — CID 165129281
4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,6,6-tetramethylpiperidine (PubChem CID 165129281) has the molecular formula C13H18F9NO and a molecular weight of 375.28 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 165129281 |
| Molecular Formula | C13H18F9NO |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CC(C)(C)N1 |
| InChI | InChI=1S/C13H18F9NO/c1-8(2)5-7(6-9(3,4)23-8)24-10(11(14,15)16,12(17,18)19)13(20,21)22/h7,23H,5-6H2,1-4H3 |
| InChIKey | BVFYIZITHMIGJB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |