About 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione
6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione (PubChem CID 165129352) has the molecular formula C14H7ClF2N2O3
and a molecular weight of 324.67 g/mol. Its IUPAC name is 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione.
Molecular Properties
| Compound Name | 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione |
| PubChem CID | 165129352 |
| Molecular Formula | C14H7ClF2N2O3 |
| Molecular Weight | 324.67 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione |
| SMILES | COC1=C(Cl)C(=O)c2[nH]c(-c3ccc(F)c(F)c3)nc2C1=O |
| InChI | InChI=1S/C14H7ClF2N2O3/c1-22-13-8(15)11(20)9-10(12(13)21)19-14(18-9)5-2-3-6(16)7(17)4-5/h2-4H,1H3,(H,18,19) |
| InChIKey | PPEBIICAOQSGNP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione?
The IUPAC name of 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione (CID 165129352) is 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione.
What is the SMILES notation for 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione?
The canonical SMILES for 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione is COC1=C(Cl)C(=O)c2[nH]c(-c3ccc(F)c(F)c3)nc2C1=O.
What is the InChIKey of 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione?
The InChIKey is PPEBIICAOQSGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7ClF2N2O3/c1-22-13-8(15)11(20)9-10(12(13)21)19-14(18-9)5-2-3-6(16)7(17)4-5/h2-4H,1H3,(H,18,19).
What are the key properties of 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione?
6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione has a molecular weight of 324.67 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(3,4-difluorophenyl)-5-methoxy-1H-benzimidazole-4,7-dione is sourced from PubChem (CID 165129352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).