C19H13ClF4N4O3 — CID 165129360
6-chloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-5-[[(3S)-2-oxopiperidin-3-yl]amino]-1H-benzimidazole-4,7-dione (PubChem CID 165129360) has the molecular formula C19H13ClF4N4O3 and a molecular weight of 456.78 g/mol. Its IUPAC name is 6-chloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-5-[[(3S)-2-oxopiperidin-3-yl]amino]-1H-benzimidazole-4,7-dione.
| Compound Name | 6-chloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-5-[[(3S)-2-oxopiperidin-3-yl]amino]-1H-benzimidazole-4,7-dione |
|---|---|
| PubChem CID | 165129360 |
| Molecular Formula | C19H13ClF4N4O3 |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 6-chloro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-5-[[(3S)-2-oxopiperidin-3-yl]amino]-1H-benzimidazole-4,7-dione |
| SMILES | O=C1C(N[C@H]2CCCNC2=O)=C(Cl)C(=O)c2[nH]c(-c3ccc(C(F)(F)F)c(F)c3)nc21 |
| InChI | InChI=1S/C19H13ClF4N4O3/c20-11-12(26-10-2-1-5-25-18(10)31)16(30)14-13(15(11)29)27-17(28-14)7-3-4-8(9(21)6-7)19(22,23)24/h3-4,6,10,26H,1-2,5H2,(H,25,31)(H,27,28)/t10-/m0/s1 |
| InChIKey | PHPYVXXNDITLTK-JTQLQIEISA-N |
| XLogP | 2.93 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|