C17H33NO2S — CID 165129655
3,3,5,5,8-pentamethyl-7-oxo-N-(1-sulfanylpropan-2-yl)nonanamide (PubChem CID 165129655) has the molecular formula C17H33NO2S and a molecular weight of 315.52 g/mol. Its IUPAC name is 3,3,5,5,8-pentamethyl-7-oxo-N-(1-sulfanylpropan-2-yl)nonanamide.
| Compound Name | 3,3,5,5,8-pentamethyl-7-oxo-N-(1-sulfanylpropan-2-yl)nonanamide |
|---|---|
| PubChem CID | 165129655 |
| Molecular Formula | C17H33NO2S |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 3,3,5,5,8-pentamethyl-7-oxo-N-(1-sulfanylpropan-2-yl)nonanamide |
| SMILES | CC(CS)NC(=O)CC(C)(C)CC(C)(C)CC(=O)C(C)C |
| InChI | InChI=1S/C17H33NO2S/c1-12(2)14(19)8-16(4,5)11-17(6,7)9-15(20)18-13(3)10-21/h12-13,21H,8-11H2,1-7H3,(H,18,20) |
| InChIKey | DEJGRJTVWWOQFL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|