About ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane
ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane (PubChem CID 165130436) has the molecular formula C27H58N4
and a molecular weight of 438.79 g/mol. Its IUPAC name is ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane |
| PubChem CID | 165130436 |
| Molecular Formula | C27H58N4 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 438.47 |
| IUPAC Name | ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane |
| SMILES | CC.CC.CC(C)N1CCC2(CCNCC2)CC1.CCN1CCC2(CCCNC2)CC1 |
| InChI | InChI=1S/C12H24N2.C11H22N2.2C2H6/c1-11(2)14-9-5-12(6-10-14)3-7-13-8-4-12;1-2-13-8-5-11(6-9-13)4-3-7-12-10-11;2*1-2/h11,13H,3-10H2,1-2H3;12H,2-10H2,1H3;2*1-2H3 |
| InChIKey | KSVPFHINNIMWIG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The IUPAC name of ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane (CID 165130436) is ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane.
What is the SMILES notation for ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The canonical SMILES for ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane is CC.CC.CC(C)N1CCC2(CCNCC2)CC1.CCN1CCC2(CCCNC2)CC1.
What is the InChIKey of ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The InChIKey is KSVPFHINNIMWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C11H22N2.2C2H6/c1-11(2)14-9-5-12(6-10-14)3-7-13-8-4-12;1-2-13-8-5-11(6-9-13)4-3-7-12-10-11;2*1-2/h11,13H,3-10H2,1-2H3;12H,2-10H2,1H3;2*1-2H3.
What are the key properties of ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane has a molecular weight of 438.79 g/mol, XLogP of 5.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-ethyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 165130436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).