About 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane
9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane (PubChem CID 165130456) has the molecular formula C22H44N4
and a molecular weight of 364.62 g/mol. Its IUPAC name is 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane |
| PubChem CID | 165130456 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane |
| SMILES | CC(C)N1CCC2(CCNCC2)CC1.CN1CCC2(CCCNC2)CC1 |
| InChI | InChI=1S/C12H24N2.C10H20N2/c1-11(2)14-9-5-12(6-10-14)3-7-13-8-4-12;1-12-7-4-10(5-8-12)3-2-6-11-9-10/h11,13H,3-10H2,1-2H3;11H,2-9H2,1H3 |
| InChIKey | NXSBXUMARFZBDF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The IUPAC name of 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane (CID 165130456) is 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The canonical SMILES for 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane is CC(C)N1CCC2(CCNCC2)CC1.CN1CCC2(CCCNC2)CC1.
What is the InChIKey of 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The InChIKey is NXSBXUMARFZBDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C10H20N2/c1-11(2)14-9-5-12(6-10-14)3-7-13-8-4-12;1-12-7-4-10(5-8-12)3-2-6-11-9-10/h11,13H,3-10H2,1-2H3;11H,2-9H2,1H3.
What are the key properties of 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane has a molecular weight of 364.62 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-2,9-diazaspiro[5.5]undecane;3-propan-2-yl-3,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 165130456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).