About [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid
[4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid (PubChem CID 165130478) has the molecular formula C14H11BN4O2S
and a molecular weight of 310.15 g/mol. Its IUPAC name is [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid |
| PubChem CID | 165130478 |
| Molecular Formula | C14H11BN4O2S |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid |
| SMILES | N#Cc1csc2c(NCc3ccc(B(O)O)cc3)ncnc12 |
| InChI | InChI=1S/C14H11BN4O2S/c16-5-10-7-22-13-12(10)18-8-19-14(13)17-6-9-1-3-11(4-2-9)15(20)21/h1-4,7-8,20-21H,6H2,(H,17,18,19) |
| InChIKey | VLITUPILDMUUCT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid?
The IUPAC name of [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid (CID 165130478) is [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid.
What is the SMILES notation for [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid?
The canonical SMILES for [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid is N#Cc1csc2c(NCc3ccc(B(O)O)cc3)ncnc12.
What is the InChIKey of [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid?
The InChIKey is VLITUPILDMUUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BN4O2S/c16-5-10-7-22-13-12(10)18-8-19-14(13)17-6-9-1-3-11(4-2-9)15(20)21/h1-4,7-8,20-21H,6H2,(H,17,18,19).
What are the key properties of [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid?
[4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid has a molecular weight of 310.15 g/mol, XLogP of 0.85, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(7-cyanothieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]boronic acid is sourced from PubChem (CID 165130478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).