About 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one
5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 165130537) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 165130537 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | Cn1cc([N+](=O)[O-])c2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C7H6N4O3/c1-10-2-4(11(13)14)5-6(10)7(12)9-3-8-5/h2-3H,1H3,(H,8,9,12) |
| InChIKey | DQYSOFFSITVEQO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one (CID 165130537) is 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one is Cn1cc([N+](=O)[O-])c2nc[nH]c(=O)c21.
What is the InChIKey of 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is DQYSOFFSITVEQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c1-10-2-4(11(13)14)5-6(10)7(12)9-3-8-5/h2-3H,1H3,(H,8,9,12).
What are the key properties of 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one?
5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 194.15 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-7-nitro-3H-pyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 165130537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).