C25H24ClN5O — CID 165131010
(E)-3-(5-chlorocyclohexa-1,3-dien-1-yl)-N-[4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-pyridinyl]prop-2-enamide (PubChem CID 165131010) has the molecular formula C25H24ClN5O and a molecular weight of 445.95 g/mol. Its IUPAC name is (E)-3-(5-chlorocyclohexa-1,3-dien-1-yl)-N-[4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chlorocyclohexa-1,3-dien-1-yl)-N-[4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 165131010 |
| Molecular Formula | C25H24ClN5O |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (E)-3-(5-chlorocyclohexa-1,3-dien-1-yl)-N-[4-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-2-pyridinyl]prop-2-enamide |
| SMILES | O=C(/C=C/C1=CC=CC(Cl)C1)Nc1cc(NCc2cn3cc(C4CC4)ccc3n2)ccn1 |
| InChI | InChI=1S/C25H24ClN5O/c26-20-3-1-2-17(12-20)4-9-25(32)30-23-13-21(10-11-27-23)28-14-22-16-31-15-19(18-5-6-18)7-8-24(31)29-22/h1-4,7-11,13,15-16,18,20H,5-6,12,14H2,(H2,27,28,30,32)/b9-4+ |
| InChIKey | UOGLXTJJSIBDDV-RUDMXATFSA-N |
| XLogP | 5.21 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|