About ethane;1-propan-2-yl-5,6-dihydrobenzimidazole
ethane;1-propan-2-yl-5,6-dihydrobenzimidazole (PubChem CID 165131061) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;1-propan-2-yl-5,6-dihydrobenzimidazole.
Molecular Properties
| Compound Name | ethane;1-propan-2-yl-5,6-dihydrobenzimidazole |
| PubChem CID | 165131061 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;1-propan-2-yl-5,6-dihydrobenzimidazole |
| SMILES | CC.CC(C)n1cnc2c1=CCCC=2 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-8(2)12-7-11-9-5-3-4-6-10(9)12;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | UPCVVVSXKYXQKL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-propan-2-yl-5,6-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-yl-5,6-dihydrobenzimidazole?
The IUPAC name of ethane;1-propan-2-yl-5,6-dihydrobenzimidazole (CID 165131061) is ethane;1-propan-2-yl-5,6-dihydrobenzimidazole.
What is the SMILES notation for ethane;1-propan-2-yl-5,6-dihydrobenzimidazole?
The canonical SMILES for ethane;1-propan-2-yl-5,6-dihydrobenzimidazole is CC.CC(C)n1cnc2c1=CCCC=2.
What is the InChIKey of ethane;1-propan-2-yl-5,6-dihydrobenzimidazole?
The InChIKey is UPCVVVSXKYXQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-8(2)12-7-11-9-5-3-4-6-10(9)12;1-2/h5-8H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;1-propan-2-yl-5,6-dihydrobenzimidazole?
ethane;1-propan-2-yl-5,6-dihydrobenzimidazole has a molecular weight of 192.31 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-yl-5,6-dihydrobenzimidazole is sourced from PubChem (CID 165131061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).