About 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide
2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide (PubChem CID 165131075) has the molecular formula C8H7ClN4O
and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide |
| PubChem CID | 165131075 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide |
| SMILES | NC(=O)Cc1ncn2ncc(Cl)cc12 |
| InChI | InChI=1S/C8H7ClN4O/c9-5-1-7-6(2-8(10)14)11-4-13(7)12-3-5/h1,3-4H,2H2,(H2,10,14) |
| InChIKey | BTXUOHZHRINMHF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide?
The IUPAC name of 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide (CID 165131075) is 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide.
What is the SMILES notation for 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide?
The canonical SMILES for 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide is NC(=O)Cc1ncn2ncc(Cl)cc12.
What is the InChIKey of 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide?
The InChIKey is BTXUOHZHRINMHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O/c9-5-1-7-6(2-8(10)14)11-4-13(7)12-3-5/h1,3-4H,2H2,(H2,10,14).
What are the key properties of 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide?
2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide has a molecular weight of 210.62 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloroimidazo[1,5-b]pyridazin-5-yl)acetamide is sourced from PubChem (CID 165131075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).