C8H10ClN3O2 — CID 165131295
2-(N,2-diamino-5-chloroanilino)acetic acid (PubChem CID 165131295) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-(N,2-diamino-5-chloroanilino)acetic acid.
| Compound Name | 2-(N,2-diamino-5-chloroanilino)acetic acid |
|---|---|
| PubChem CID | 165131295 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(N,2-diamino-5-chloroanilino)acetic acid |
| SMILES | Nc1ccc(Cl)cc1N(N)CC(=O)O |
| InChI | InChI=1S/C8H10ClN3O2/c9-5-1-2-6(10)7(3-5)12(11)4-8(13)14/h1-3H,4,10-11H2,(H,13,14) |
| InChIKey | WIMPOMAJFUVZBY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|