C24H27FN10O — CID 165131318
N,N'-diamino-N-[2-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]pyrimidin-4-yl]amino]methyl]-3-fluoro-4-methoxyphenyl]methanimidamide (PubChem CID 165131318) has the molecular formula C24H27FN10O and a molecular weight of 490.55 g/mol. Its IUPAC name is N,N'-diamino-N-[2-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]pyrimidin-4-yl]amino]methyl]-3-fluoro-4-methoxyphenyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]pyrimidin-4-yl]amino]methyl]-3-fluoro-4-methoxyphenyl]methanimidamide |
|---|---|
| PubChem CID | 165131318 |
| Molecular Formula | C24H27FN10O |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N,N'-diamino-N-[2-[[[6-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]pyrimidin-4-yl]amino]methyl]-3-fluoro-4-methoxyphenyl]methanimidamide |
| SMILES | COc1ccc(N(N)/C=N\N)c(CNc2cc(NCc3cn4cc(C5CC5)ccc4n3)ncn2)c1F |
| InChI | InChI=1S/C24H27FN10O/c1-36-20-6-5-19(35(27)14-32-26)18(24(20)25)10-29-22-8-21(30-13-31-22)28-9-17-12-34-11-16(15-2-3-15)4-7-23(34)33-17/h4-8,11-15H,2-3,9-10,26-27H2,1H3,(H2,28,29,30,31)/b32-14- |
| InChIKey | OIPMRWACOLGIFM-LPEPFOFCSA-N |
| XLogP | 2.96 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|