About ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one
ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one (PubChem CID 165131331) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one |
| PubChem CID | 165131331 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one |
| SMILES | CC.CC.Cn1c(=O)oc2c1=CCCC=2 |
| InChI | InChI=1S/C8H9NO2.2C2H6/c1-9-6-4-2-3-5-7(6)11-8(9)10;2*1-2/h4-5H,2-3H2,1H3;2*1-2H3 |
| InChIKey | PZRANBYAIXBCSL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one?
The IUPAC name of ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one (CID 165131331) is ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one.
What is the SMILES notation for ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one?
The canonical SMILES for ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one is CC.CC.Cn1c(=O)oc2c1=CCCC=2.
What is the InChIKey of ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one?
The InChIKey is PZRANBYAIXBCSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.2C2H6/c1-9-6-4-2-3-5-7(6)11-8(9)10;2*1-2/h4-5H,2-3H2,1H3;2*1-2H3.
What are the key properties of ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one?
ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one has a molecular weight of 211.30 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6-dihydro-1,3-benzoxazol-2-one is sourced from PubChem (CID 165131331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).