About (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine
(Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine (PubChem CID 165132341) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine.
Molecular Properties
| Compound Name | (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine |
| PubChem CID | 165132341 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine |
| SMILES | C=N/C=C\C(C)=N\CC1CC1 |
| InChI | InChI=1S/C9H14N2/c1-8(5-6-10-2)11-7-9-3-4-9/h5-6,9H,2-4,7H2,1H3/b6-5-,11-8+ |
| InChIKey | KNRVNFCOTVLOOU-ZLQDEDOTSA-N |
| XLogP | 2.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine?
The IUPAC name of (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine (CID 165132341) is (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine.
What is the SMILES notation for (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine?
The canonical SMILES for (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine is C=N/C=C\C(C)=N\CC1CC1.
What is the InChIKey of (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine?
The InChIKey is KNRVNFCOTVLOOU-ZLQDEDOTSA-N. The full InChI is InChI=1S/C9H14N2/c1-8(5-6-10-2)11-7-9-3-4-9/h5-6,9H,2-4,7H2,1H3/b6-5-,11-8+.
What are the key properties of (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine?
(Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine has a molecular weight of 150.22 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N-(cyclopropylmethyl)-4-N-methylidenebut-3-ene-2,4-diimine is sourced from PubChem (CID 165132341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).