About [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 16513259) has the molecular formula C20H16F2N2O5S2
and a molecular weight of 466.49 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
Molecular Properties
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| PubChem CID | 16513259 |
| Molecular Formula | C20H16F2N2O5S2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H16F2N2O5S2/c1-12(17(25)24-20-23-16(11-30-20)13-5-3-2-4-6-13)29-18(26)14-7-9-15(10-8-14)31(27,28)19(21)22/h2-12,19H,1H3,(H,23,24,25) |
| InChIKey | FJHHRBYOEYBPEY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate?
The IUPAC name of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate (CID 16513259) is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
What is the SMILES notation for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate?
The canonical SMILES for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate is CC(OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)C(=O)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate?
The InChIKey is FJHHRBYOEYBPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N2O5S2/c1-12(17(25)24-20-23-16(11-30-20)13-5-3-2-4-6-13)29-18(26)14-7-9-15(10-8-14)31(27,28)19(21)22/h2-12,19H,1H3,(H,23,24,25).
What are the key properties of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate?
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate has a molecular weight of 466.49 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-(difluoromethylsulfonyl)benzoate is sourced from PubChem (CID 16513259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).