C20H22N8O3 — CID 165132973
N-[6-[[(1R)-1-[6-ethyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]ethyl]amino]pyrimidin-4-yl]formamide (PubChem CID 165132973) has the molecular formula C20H22N8O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[6-[[(1R)-1-[6-ethyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]ethyl]amino]pyrimidin-4-yl]formamide.
| Compound Name | N-[6-[[(1R)-1-[6-ethyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]ethyl]amino]pyrimidin-4-yl]formamide |
|---|---|
| PubChem CID | 165132973 |
| Molecular Formula | C20H22N8O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[6-[[(1R)-1-[6-ethyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]ethyl]amino]pyrimidin-4-yl]formamide |
| SMILES | CCc1cc(N2CC(=O)N(C)C2=O)c2nc([C@@H](C)Nc3cc(NC=O)ncn3)cn2c1 |
| InChI | InChI=1S/C20H22N8O3/c1-4-13-5-15(28-9-18(30)26(3)20(28)31)19-25-14(8-27(19)7-13)12(2)24-17-6-16(23-11-29)21-10-22-17/h5-8,10-12H,4,9H2,1-3H3,(H2,21,22,23,24,29)/t12-/m1/s1 |
| InChIKey | CDEVWVDIKJMRBB-GFCCVEGCSA-N |
| XLogP | 1.83 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|