C16H26N6 — CID 165133239
(Z)-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-ene-1,2-diamine;ethane (PubChem CID 165133239) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is (Z)-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-ene-1,2-diamine;ethane.
| Compound Name | (Z)-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-ene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 165133239 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (Z)-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-ene-1,2-diamine;ethane |
| SMILES | CC.NC/C(N)=C/N(N)Cc1cn2cc(C3CC3)ccc2n1 |
| InChI | InChI=1S/C14H20N6.C2H6/c15-5-12(16)7-20(17)9-13-8-19-6-11(10-1-2-10)3-4-14(19)18-13;1-2/h3-4,6-8,10H,1-2,5,9,15-17H2;1-2H3/b12-7-; |
| InChIKey | XIHVSJNTXPMTLP-OZLKFZLXSA-N |
| XLogP | 1.67 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|