About ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol
ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol (PubChem CID 165133315) has the molecular formula C13H28N2OS
and a molecular weight of 260.45 g/mol. Its IUPAC name is ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol.
Molecular Properties
| Compound Name | ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol |
| PubChem CID | 165133315 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol |
| SMILES | CC.CC.CCc1nccc(C(C)C)n1.OS |
| InChI | InChI=1S/C9H14N2.2C2H6.H2OS/c1-4-9-10-6-5-8(11-9)7(2)3;3*1-2/h5-7H,4H2,1-3H3;2*1-2H3;1-2H |
| InChIKey | OKMARTFOTHHCHU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol?
The IUPAC name of ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol (CID 165133315) is ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol.
What is the SMILES notation for ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol?
The canonical SMILES for ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol is CC.CC.CCc1nccc(C(C)C)n1.OS.
What is the InChIKey of ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol?
The InChIKey is OKMARTFOTHHCHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.2C2H6.H2OS/c1-4-9-10-6-5-8(11-9)7(2)3;3*1-2/h5-7H,4H2,1-3H3;2*1-2H3;1-2H.
What are the key properties of ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol?
ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol has a molecular weight of 260.45 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-4-propan-2-ylpyrimidine;sulfanol is sourced from PubChem (CID 165133315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).