C28H23N5O — CID 165134114
1,1-diphenyl-N-[5-[[4-(pyrazol-1-ylmethyl)phenyl]methoxy]pyridazin-3-yl]methanimine (PubChem CID 165134114) has the molecular formula C28H23N5O and a molecular weight of 445.53 g/mol. Its IUPAC name is 1,1-diphenyl-N-[5-[[4-(pyrazol-1-ylmethyl)phenyl]methoxy]pyridazin-3-yl]methanimine.
| Compound Name | 1,1-diphenyl-N-[5-[[4-(pyrazol-1-ylmethyl)phenyl]methoxy]pyridazin-3-yl]methanimine |
|---|---|
| PubChem CID | 165134114 |
| Molecular Formula | C28H23N5O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1,1-diphenyl-N-[5-[[4-(pyrazol-1-ylmethyl)phenyl]methoxy]pyridazin-3-yl]methanimine |
| SMILES | c1ccc(C(=Nc2cc(OCc3ccc(Cn4cccn4)cc3)cnn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N5O/c1-3-8-24(9-4-1)28(25-10-5-2-6-11-25)31-27-18-26(19-29-32-27)34-21-23-14-12-22(13-15-23)20-33-17-7-16-30-33/h1-19H,20-21H2 |
| InChIKey | TWKACSZNBNITDO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|