About N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine
N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine (PubChem CID 165134865) has the molecular formula C19H32N4
and a molecular weight of 316.49 g/mol. Its IUPAC name is N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine.
Molecular Properties
| Compound Name | N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine |
| PubChem CID | 165134865 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine |
| SMILES | C/N=C/N.CC/C(C)=C(/N)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26N2.C2H6N2/c1-3-14(2)17(18)16-9-7-15(8-10-16)13-19-11-5-4-6-12-19;1-4-2-3/h7-10H,3-6,11-13,18H2,1-2H3;2H,1H3,(H2,3,4)/b17-14+; |
| InChIKey | ZZKOCBPCXSSBGB-KLSJZZFUSA-N |
| XLogP | 3.38 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine?
The IUPAC name of N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine (CID 165134865) is N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine.
What is the SMILES notation for N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine?
The canonical SMILES for N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine is C/N=C/N.CC/C(C)=C(/N)c1ccc(CN2CCCCC2)cc1.
What is the InChIKey of N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine?
The InChIKey is ZZKOCBPCXSSBGB-KLSJZZFUSA-N. The full InChI is InChI=1S/C17H26N2.C2H6N2/c1-3-14(2)17(18)16-9-7-15(8-10-16)13-19-11-5-4-6-12-19;1-4-2-3/h7-10H,3-6,11-13,18H2,1-2H3;2H,1H3,(H2,3,4)/b17-14+;.
What are the key properties of N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine?
N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine has a molecular weight of 316.49 g/mol, XLogP of 3.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylmethanimidamide;(E)-2-methyl-1-[4-(piperidin-1-ylmethyl)phenyl]but-1-en-1-amine is sourced from PubChem (CID 165134865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).