About N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane
N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane (PubChem CID 165134961) has the molecular formula C19H34ClNO
and a molecular weight of 327.94 g/mol. Its IUPAC name is N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane.
Molecular Properties
| Compound Name | N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane |
| PubChem CID | 165134961 |
| Molecular Formula | C19H34ClNO |
| Molecular Weight | 327.94 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane |
| SMILES | CCCCN(C)CCC(C)(C)c1ccc(Cl)cc1.CCOC |
| InChI | InChI=1S/C16H26ClN.C3H8O/c1-5-6-12-18(4)13-11-16(2,3)14-7-9-15(17)10-8-14;1-3-4-2/h7-10H,5-6,11-13H2,1-4H3;3H2,1-2H3 |
| InChIKey | XYXFOOHBUWPSOB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane?
The IUPAC name of N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane (CID 165134961) is N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane.
What is the SMILES notation for N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane?
The canonical SMILES for N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane is CCCCN(C)CCC(C)(C)c1ccc(Cl)cc1.CCOC.
What is the InChIKey of N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane?
The InChIKey is XYXFOOHBUWPSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26ClN.C3H8O/c1-5-6-12-18(4)13-11-16(2,3)14-7-9-15(17)10-8-14;1-3-4-2/h7-10H,5-6,11-13H2,1-4H3;3H2,1-2H3.
What are the key properties of N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane?
N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane has a molecular weight of 327.94 g/mol, XLogP of 5.39, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3-(4-chlorophenyl)-N,3-dimethylbutan-1-amine;methoxyethane is sourced from PubChem (CID 165134961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).