About (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine
(E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine (PubChem CID 165135042) has the molecular formula C8H14F2IN
and a molecular weight of 289.11 g/mol. Its IUPAC name is (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine |
| PubChem CID | 165135042 |
| Molecular Formula | C8H14F2IN |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine |
| SMILES | C=IC(F)(F)/C(C)=C/NC(C)C |
| InChI | InChI=1S/C8H14F2IN/c1-6(2)12-5-7(3)8(9,10)11-4/h5-6,12H,4H2,1-3H3/b7-5+ |
| InChIKey | AOHCXAUVUMVJQL-FNORWQNLSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine?
The IUPAC name of (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine (CID 165135042) is (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine.
What is the SMILES notation for (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine?
The canonical SMILES for (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine is C=IC(F)(F)/C(C)=C/NC(C)C.
What is the InChIKey of (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine?
The InChIKey is AOHCXAUVUMVJQL-FNORWQNLSA-N. The full InChI is InChI=1S/C8H14F2IN/c1-6(2)12-5-7(3)8(9,10)11-4/h5-6,12H,4H2,1-3H3/b7-5+.
What are the key properties of (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine?
(E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine has a molecular weight of 289.11 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,3-difluoro-2-methyl-3-(methylidene-λ3-iodanyl)-N-propan-2-ylprop-1-en-1-amine is sourced from PubChem (CID 165135042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).