C14H18BF3N2O2 — CID 165135096
4-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 165135096) has the molecular formula C14H18BF3N2O2 and a molecular weight of 314.12 g/mol. Its IUPAC name is 4-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 165135096 |
| Molecular Formula | C14H18BF3N2O2 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | CC1(C)OB(c2c(C3CC3)ncnc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C14H18BF3N2O2/c1-12(2)13(3,4)22-15(21-12)9-10(8-5-6-8)19-7-20-11(9)14(16,17)18/h7-8H,5-6H2,1-4H3 |
| InChIKey | HKRDLPALPACYAK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|