About 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione
7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione (PubChem CID 165135440) has the molecular formula C11H8O3S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione.
Molecular Properties
| Compound Name | 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione |
| PubChem CID | 165135440 |
| Molecular Formula | C11H8O3S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione |
| SMILES | O=C1CCCc2oc(=O)c3sccc3c21 |
| InChI | InChI=1S/C11H8O3S/c12-7-2-1-3-8-9(7)6-4-5-15-10(6)11(13)14-8/h4-5H,1-3H2 |
| InChIKey | NQVCJYPWNWJVGE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione?
The IUPAC name of 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione (CID 165135440) is 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione.
What is the SMILES notation for 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione?
The canonical SMILES for 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione is O=C1CCCc2oc(=O)c3sccc3c21.
What is the InChIKey of 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione?
The InChIKey is NQVCJYPWNWJVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3S/c12-7-2-1-3-8-9(7)6-4-5-15-10(6)11(13)14-8/h4-5H,1-3H2.
What are the key properties of 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione?
7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione has a molecular weight of 220.25 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-6H-thieno[2,3-c]chromene-4,9-dione is sourced from PubChem (CID 165135440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).