C14H23F2NS — CID 165135903
1,1-difluoro-2-methylpropan-1-amine;2-methylpropylsulfanylbenzene (PubChem CID 165135903) has the molecular formula C14H23F2NS and a molecular weight of 275.41 g/mol. Its IUPAC name is 1,1-difluoro-2-methylpropan-1-amine;2-methylpropylsulfanylbenzene.
| Compound Name | 1,1-difluoro-2-methylpropan-1-amine;2-methylpropylsulfanylbenzene |
|---|---|
| PubChem CID | 165135903 |
| Molecular Formula | C14H23F2NS |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1,1-difluoro-2-methylpropan-1-amine;2-methylpropylsulfanylbenzene |
| SMILES | CC(C)C(N)(F)F.CC(C)CSc1ccccc1 |
| InChI | InChI=1S/C10H14S.C4H9F2N/c1-9(2)8-11-10-6-4-3-5-7-10;1-3(2)4(5,6)7/h3-7,9H,8H2,1-2H3;3H,7H2,1-2H3 |
| InChIKey | ZNBNWIZTZOJULK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|