C18H35N3O — CID 165137620
ethane;1-N-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl]-1-N-methylprop-2-ene-1,2-diamine (PubChem CID 165137620) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is ethane;1-N-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl]-1-N-methylprop-2-ene-1,2-diamine.
| Compound Name | ethane;1-N-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl]-1-N-methylprop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 165137620 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | ethane;1-N-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl]-1-N-methylprop-2-ene-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCCN(C)CCN(C)CC(=C)N.CC |
| InChI | InChI=1S/C16H29N3O.C2H6/c1-6-7-9-16(3)20-13-8-10-18(4)11-12-19(5)14-15(2)17;1-2/h6-7,9H,1-3,8,10-14,17H2,4-5H3;1-2H3/b9-7-; |
| InChIKey | AXAHXDWOQJIUTM-VILQZVERSA-N |
| XLogP | 3.01 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|