C12H24FN3 — CID 165138110
1-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]methyl]piperazine (PubChem CID 165138110) has the molecular formula C12H24FN3 and a molecular weight of 229.34 g/mol. Its IUPAC name is 1-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]methyl]piperazine.
| Compound Name | 1-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 165138110 |
| Molecular Formula | C12H24FN3 |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]methyl]piperazine |
| SMILES | CCN1CC[C@@H](CN2CCNCC2)[C@@H](F)C1 |
| InChI | InChI=1S/C12H24FN3/c1-2-15-6-3-11(12(13)10-15)9-16-7-4-14-5-8-16/h11-12,14H,2-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | WTGZPUNBXPPRBV-RYUDHWBXSA-N |
| XLogP | 0.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |