About 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine
3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine (PubChem CID 165139770) has the molecular formula C11H10F3N
and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine.
Molecular Properties
| Compound Name | 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine |
| PubChem CID | 165139770 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine |
| SMILES | C=Cc1ccc(C2CC(F)(F)C2)c(F)n1 |
| InChI | InChI=1S/C11H10F3N/c1-2-8-3-4-9(10(12)15-8)7-5-11(13,14)6-7/h2-4,7H,1,5-6H2 |
| InChIKey | CQJDHCKAVRZSKU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine?
The IUPAC name of 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine (CID 165139770) is 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine.
What is the SMILES notation for 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine?
The canonical SMILES for 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine is C=Cc1ccc(C2CC(F)(F)C2)c(F)n1.
What is the InChIKey of 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine?
The InChIKey is CQJDHCKAVRZSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N/c1-2-8-3-4-9(10(12)15-8)7-5-11(13,14)6-7/h2-4,7H,1,5-6H2.
What are the key properties of 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine?
3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine has a molecular weight of 213.20 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluorocyclobutyl)-6-ethenyl-2-fluoropyridine is sourced from PubChem (CID 165139770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).