C28H29FN4O3 — CID 165140336
4-fluoro-1-[2-oxo-2-(pyridin-3-ylamino)acetyl]-N-[phenyl-(4-propan-2-ylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 165140336) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is 4-fluoro-1-[2-oxo-2-(pyridin-3-ylamino)acetyl]-N-[phenyl-(4-propan-2-ylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-fluoro-1-[2-oxo-2-(pyridin-3-ylamino)acetyl]-N-[phenyl-(4-propan-2-ylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 165140336 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 4-fluoro-1-[2-oxo-2-(pyridin-3-ylamino)acetyl]-N-[phenyl-(4-propan-2-ylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)c1ccc(C(NC(=O)C2CC(F)CN2C(=O)C(=O)Nc2cccnc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29FN4O3/c1-18(2)19-10-12-21(13-11-19)25(20-7-4-3-5-8-20)32-26(34)24-15-22(29)17-33(24)28(36)27(35)31-23-9-6-14-30-16-23/h3-14,16,18,22,24-25H,15,17H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | QRADETHAJBEWIA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|