C27H40FN7 — CID 165140376
4-[(3-fluoro-4-propan-2-ylphenyl)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]methyl]pyridin-2-amine;(1Z)-2-hydrazinylpenta-1,4-dien-1-amine (PubChem CID 165140376) has the molecular formula C27H40FN7 and a molecular weight of 481.66 g/mol. Its IUPAC name is 4-[(3-fluoro-4-propan-2-ylphenyl)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]methyl]pyridin-2-amine;(1Z)-2-hydrazinylpenta-1,4-dien-1-amine.
| Compound Name | 4-[(3-fluoro-4-propan-2-ylphenyl)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]methyl]pyridin-2-amine;(1Z)-2-hydrazinylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 165140376 |
| Molecular Formula | C27H40FN7 |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 4-[(3-fluoro-4-propan-2-ylphenyl)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]methyl]pyridin-2-amine;(1Z)-2-hydrazinylpenta-1,4-dien-1-amine |
| SMILES | C=C(NC(c1ccnc(N)c1)c1ccc(C(C)C)c(F)c1)C1CCCN1C.C=CC/C(=C/N)NN |
| InChI | InChI=1S/C22H29FN4.C5H11N3/c1-14(2)18-8-7-16(12-19(18)23)22(17-9-10-25-21(24)13-17)26-15(3)20-6-5-11-27(20)4;1-2-3-5(4-6)8-7/h7-10,12-14,20,22,26H,3,5-6,11H2,1-2,4H3,(H2,24,25);2,4,8H,1,3,6-7H2/b;5-4- |
| InChIKey | UJJFCTGLGGWFII-GUHKXDMSSA-N |
| XLogP | 4.04 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|