C29H38F6N6 — CID 165140642
N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;(2Z)-1,1,1-trifluoro-3-hydrazinylhexa-2,5-dien-2-amine (PubChem CID 165140642) has the molecular formula C29H38F6N6 and a molecular weight of 584.65 g/mol. Its IUPAC name is N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;(2Z)-1,1,1-trifluoro-3-hydrazinylhexa-2,5-dien-2-amine.
| Compound Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;(2Z)-1,1,1-trifluoro-3-hydrazinylhexa-2,5-dien-2-amine |
|---|---|
| PubChem CID | 165140642 |
| Molecular Formula | C29H38F6N6 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;(2Z)-1,1,1-trifluoro-3-hydrazinylhexa-2,5-dien-2-amine |
| SMILES | C=C(NCc1ccccc1)C1CCCN1C.C=CC/C(NN)=C(/N)C(F)(F)F.Fc1ncccc1C1CC(F)(F)C1 |
| InChI | InChI=1S/C14H20N2.C9H8F3N.C6H10F3N3/c1-12(14-9-6-10-16(14)2)15-11-13-7-4-3-5-8-13;10-8-7(2-1-3-13-8)6-4-9(11,12)5-6;1-2-3-4(12-11)5(10)6(7,8)9/h3-5,7-8,14-15H,1,6,9-11H2,2H3;1-3,6H,4-5H2;2,12H,1,3,10-11H2/b;;5-4- |
| InChIKey | RAKKFXBBTOAXPV-GDUSTKMHSA-N |
| XLogP | 5.88 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|